About benzyl 4-[3-[(2,2,2-trifluoroacetyl)amino]-2-pyridinyl]piperazine-1-carboxylate
benzyl 4-[3-[(2,2,2-trifluoroacetyl)amino]-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 21477603) has the molecular formula C19H19F3N4O3
and a molecular weight of 408.38 g/mol. Its IUPAC name is benzyl 4-[3-[(2,2,2-trifluoroacetyl)amino]-2-pyridinyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | benzyl 4-[3-[(2,2,2-trifluoroacetyl)amino]-2-pyridinyl]piperazine-1-carboxylate |
| PubChem CID | 21477603 |
| Molecular Formula | C19H19F3N4O3 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | benzyl 4-[3-[(2,2,2-trifluoroacetyl)amino]-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCN(c2ncccc2NC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H19F3N4O3/c20-19(21,22)17(27)24-15-7-4-8-23-16(15)25-9-11-26(12-10-25)18(28)29-13-14-5-2-1-3-6-14/h1-8H,9-13H2,(H,24,27) |
| InChIKey | KCJWOBHFWQPTQY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl 4-[3-[(2,2,2-trifluoroacetyl)amino]-2-pyridinyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-[3-[(2,2,2-trifluoroacetyl)amino]-2-pyridinyl]piperazine-1-carboxylate?
The IUPAC name of benzyl 4-[3-[(2,2,2-trifluoroacetyl)amino]-2-pyridinyl]piperazine-1-carboxylate (CID 21477603) is benzyl 4-[3-[(2,2,2-trifluoroacetyl)amino]-2-pyridinyl]piperazine-1-carboxylate.
What is the SMILES notation for benzyl 4-[3-[(2,2,2-trifluoroacetyl)amino]-2-pyridinyl]piperazine-1-carboxylate?
The canonical SMILES for benzyl 4-[3-[(2,2,2-trifluoroacetyl)amino]-2-pyridinyl]piperazine-1-carboxylate is O=C(OCc1ccccc1)N1CCN(c2ncccc2NC(=O)C(F)(F)F)CC1.
What is the InChIKey of benzyl 4-[3-[(2,2,2-trifluoroacetyl)amino]-2-pyridinyl]piperazine-1-carboxylate?
The InChIKey is KCJWOBHFWQPTQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19F3N4O3/c20-19(21,22)17(27)24-15-7-4-8-23-16(15)25-9-11-26(12-10-25)18(28)29-13-14-5-2-1-3-6-14/h1-8H,9-13H2,(H,24,27).
What are the key properties of benzyl 4-[3-[(2,2,2-trifluoroacetyl)amino]-2-pyridinyl]piperazine-1-carboxylate?
benzyl 4-[3-[(2,2,2-trifluoroacetyl)amino]-2-pyridinyl]piperazine-1-carboxylate has a molecular weight of 408.38 g/mol, XLogP of 3.04, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-[3-[(2,2,2-trifluoroacetyl)amino]-2-pyridinyl]piperazine-1-carboxylate is sourced from PubChem (CID 21477603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).