C13H21N — CID 21477925
1,2,3,4,4a,5,6,7,8,8a,10,10a-dodecahydroacridine (PubChem CID 21477925) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a,10,10a-dodecahydroacridine.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a,10,10a-dodecahydroacridine |
|---|---|
| PubChem CID | 21477925 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a,10,10a-dodecahydroacridine |
| SMILES | C1=C2CCCCC2NC2CCCCC12 |
| InChI | InChI=1S/C13H21N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h9-10,12-14H,1-8H2 |
| InChIKey | DPCLRILNWPMEIS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|