About 3,5-diethyl-2-propyl-1,2-dihydropyridine
3,5-diethyl-2-propyl-1,2-dihydropyridine (PubChem CID 21477926) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is 3,5-diethyl-2-propyl-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 3,5-diethyl-2-propyl-1,2-dihydropyridine |
| PubChem CID | 21477926 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 3,5-diethyl-2-propyl-1,2-dihydropyridine |
| SMILES | CCCC1NC=C(CC)C=C1CC |
| InChI | InChI=1S/C12H21N/c1-4-7-12-11(6-3)8-10(5-2)9-13-12/h8-9,12-13H,4-7H2,1-3H3 |
| InChIKey | PJNHPCMGEVJGFD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,5-diethyl-2-propyl-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diethyl-2-propyl-1,2-dihydropyridine?
The IUPAC name of 3,5-diethyl-2-propyl-1,2-dihydropyridine (CID 21477926) is 3,5-diethyl-2-propyl-1,2-dihydropyridine.
What is the SMILES notation for 3,5-diethyl-2-propyl-1,2-dihydropyridine?
The canonical SMILES for 3,5-diethyl-2-propyl-1,2-dihydropyridine is CCCC1NC=C(CC)C=C1CC.
What is the InChIKey of 3,5-diethyl-2-propyl-1,2-dihydropyridine?
The InChIKey is PJNHPCMGEVJGFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N/c1-4-7-12-11(6-3)8-10(5-2)9-13-12/h8-9,12-13H,4-7H2,1-3H3.
What are the key properties of 3,5-diethyl-2-propyl-1,2-dihydropyridine?
3,5-diethyl-2-propyl-1,2-dihydropyridine has a molecular weight of 179.31 g/mol, XLogP of 3.39, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diethyl-2-propyl-1,2-dihydropyridine is sourced from PubChem (CID 21477926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).