About 1-ethyl-2,3-dimethylimidazolidine
1-ethyl-2,3-dimethylimidazolidine (PubChem CID 21478047) has the molecular formula C7H16N2
and a molecular weight of 128.22 g/mol. Its IUPAC name is 1-ethyl-2,3-dimethylimidazolidine.
Molecular Properties
| Compound Name | 1-ethyl-2,3-dimethylimidazolidine |
| PubChem CID | 21478047 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | 1-ethyl-2,3-dimethylimidazolidine |
| SMILES | CCN1CCN(C)C1C |
| InChI | InChI=1S/C7H16N2/c1-4-9-6-5-8(3)7(9)2/h7H,4-6H2,1-3H3 |
| InChIKey | JIFXKZJGKSXAGZ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethyl-2,3-dimethylimidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2,3-dimethylimidazolidine?
The IUPAC name of 1-ethyl-2,3-dimethylimidazolidine (CID 21478047) is 1-ethyl-2,3-dimethylimidazolidine.
What is the SMILES notation for 1-ethyl-2,3-dimethylimidazolidine?
The canonical SMILES for 1-ethyl-2,3-dimethylimidazolidine is CCN1CCN(C)C1C.
What is the InChIKey of 1-ethyl-2,3-dimethylimidazolidine?
The InChIKey is JIFXKZJGKSXAGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2/c1-4-9-6-5-8(3)7(9)2/h7H,4-6H2,1-3H3.
What are the key properties of 1-ethyl-2,3-dimethylimidazolidine?
1-ethyl-2,3-dimethylimidazolidine has a molecular weight of 128.22 g/mol, XLogP of 0.60, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2,3-dimethylimidazolidine is sourced from PubChem (CID 21478047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).