C12H6Cl3F3N2O2 — CID 21478111
3-[(2,3,5-trichlorophenyl)methyl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione (PubChem CID 21478111) has the molecular formula C12H6Cl3F3N2O2 and a molecular weight of 373.55 g/mol. Its IUPAC name is 3-[(2,3,5-trichlorophenyl)methyl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 3-[(2,3,5-trichlorophenyl)methyl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 21478111 |
| Molecular Formula | C12H6Cl3F3N2O2 |
| Molecular Weight | 373.55 g/mol |
| Exact Mass | 371.94 |
| IUPAC Name | 3-[(2,3,5-trichlorophenyl)methyl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1cc(C(F)(F)F)[nH]c(=O)n1Cc1cc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C12H6Cl3F3N2O2/c13-6-1-5(10(15)7(14)2-6)4-20-9(21)3-8(12(16,17)18)19-11(20)22/h1-3H,4H2,(H,19,22) |
| InChIKey | XZSOSJSSRFSOMK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.55 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|