About 1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine
1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine (PubChem CID 21478202) has the molecular formula C6H12N4S
and a molecular weight of 172.26 g/mol. Its IUPAC name is 1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine.
Molecular Properties
| Compound Name | 1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine |
| PubChem CID | 21478202 |
| Molecular Formula | C6H12N4S |
| Molecular Weight | 172.26 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine |
| SMILES | CC(N)CSc1nncn1C |
| InChI | InChI=1S/C6H12N4S/c1-5(7)3-11-6-9-8-4-10(6)2/h4-5H,3,7H2,1-2H3 |
| InChIKey | CYHFRAYHJMDZKP-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.26 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine?
The IUPAC name of 1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine (CID 21478202) is 1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine.
What is the SMILES notation for 1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine?
The canonical SMILES for 1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine is CC(N)CSc1nncn1C.
What is the InChIKey of 1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine?
The InChIKey is CYHFRAYHJMDZKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4S/c1-5(7)3-11-6-9-8-4-10(6)2/h4-5H,3,7H2,1-2H3.
What are the key properties of 1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine?
1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine has a molecular weight of 172.26 g/mol, XLogP of 0.25, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propan-2-amine is sourced from PubChem (CID 21478202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).