C29H39N3O3 — CID 21478479
4-cyclohexyl-2-[[1-[[4-(dimethylamino)phenyl]methyl]-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]amino]butanoic acid (PubChem CID 21478479) has the molecular formula C29H39N3O3 and a molecular weight of 477.65 g/mol. Its IUPAC name is 4-cyclohexyl-2-[[1-[[4-(dimethylamino)phenyl]methyl]-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]amino]butanoic acid.
| Compound Name | 4-cyclohexyl-2-[[1-[[4-(dimethylamino)phenyl]methyl]-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 21478479 |
| Molecular Formula | C29H39N3O3 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.30 |
| IUPAC Name | 4-cyclohexyl-2-[[1-[[4-(dimethylamino)phenyl]methyl]-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl]amino]butanoic acid |
| SMILES | CN(C)c1ccc(CN2C(=O)C(NC(CCC3CCCCC3)C(=O)O)CCc3ccccc32)cc1 |
| InChI | InChI=1S/C29H39N3O3/c1-31(2)24-16-12-22(13-17-24)20-32-27-11-7-6-10-23(27)15-19-25(28(32)33)30-26(29(34)35)18-14-21-8-4-3-5-9-21/h6-7,10-13,16-17,21,25-26,30H,3-5,8-9,14-15,18-20H2,1-2H3,(H,34,35) |
| InChIKey | VUTPHDMFFNXHBA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|