C15H20N4O — CID 21478631
4-(3-methoxypropyl)-1-propyl-[1,2,4]triazolo[4,3-a]benzimidazole (PubChem CID 21478631) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 4-(3-methoxypropyl)-1-propyl-[1,2,4]triazolo[4,3-a]benzimidazole.
| Compound Name | 4-(3-methoxypropyl)-1-propyl-[1,2,4]triazolo[4,3-a]benzimidazole |
|---|---|
| PubChem CID | 21478631 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 4-(3-methoxypropyl)-1-propyl-[1,2,4]triazolo[4,3-a]benzimidazole |
| SMILES | CCCc1nnc2n(CCCOC)c3ccccc3n12 |
| InChI | InChI=1S/C15H20N4O/c1-3-7-14-16-17-15-18(10-6-11-20-2)12-8-4-5-9-13(12)19(14)15/h4-5,8-9H,3,6-7,10-11H2,1-2H3 |
| InChIKey | LDEPBNFVMLEVSI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 44.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|