About 2-(4-bromo-4,4-difluorobutyl)sulfanyl-4-methylpyrimidine
2-(4-bromo-4,4-difluorobutyl)sulfanyl-4-methylpyrimidine (PubChem CID 21478882) has the molecular formula C9H11BrF2N2S
and a molecular weight of 297.17 g/mol. Its IUPAC name is 2-(4-bromo-4,4-difluorobutyl)sulfanyl-4-methylpyrimidine.
Molecular Properties
| Compound Name | 2-(4-bromo-4,4-difluorobutyl)sulfanyl-4-methylpyrimidine |
| PubChem CID | 21478882 |
| Molecular Formula | C9H11BrF2N2S |
| Molecular Weight | 297.17 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | 2-(4-bromo-4,4-difluorobutyl)sulfanyl-4-methylpyrimidine |
| SMILES | Cc1ccnc(SCCCC(F)(F)Br)n1 |
| InChI | InChI=1S/C9H11BrF2N2S/c1-7-3-5-13-8(14-7)15-6-2-4-9(10,11)12/h3,5H,2,4,6H2,1H3 |
| InChIKey | QUJNSEHNDAIIIK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.17 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromo-4,4-difluorobutyl)sulfanyl-4-methylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromo-4,4-difluorobutyl)sulfanyl-4-methylpyrimidine?
The IUPAC name of 2-(4-bromo-4,4-difluorobutyl)sulfanyl-4-methylpyrimidine (CID 21478882) is 2-(4-bromo-4,4-difluorobutyl)sulfanyl-4-methylpyrimidine.
What is the SMILES notation for 2-(4-bromo-4,4-difluorobutyl)sulfanyl-4-methylpyrimidine?
The canonical SMILES for 2-(4-bromo-4,4-difluorobutyl)sulfanyl-4-methylpyrimidine is Cc1ccnc(SCCCC(F)(F)Br)n1.
What is the InChIKey of 2-(4-bromo-4,4-difluorobutyl)sulfanyl-4-methylpyrimidine?
The InChIKey is QUJNSEHNDAIIIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrF2N2S/c1-7-3-5-13-8(14-7)15-6-2-4-9(10,11)12/h3,5H,2,4,6H2,1H3.
What are the key properties of 2-(4-bromo-4,4-difluorobutyl)sulfanyl-4-methylpyrimidine?
2-(4-bromo-4,4-difluorobutyl)sulfanyl-4-methylpyrimidine has a molecular weight of 297.17 g/mol, XLogP of 3.65, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-4,4-difluorobutyl)sulfanyl-4-methylpyrimidine is sourced from PubChem (CID 21478882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).