C11H18N2 — CID 21479123
3-butyl-1,2,3a,7a-tetrahydrobenzimidazole (PubChem CID 21479123) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 3-butyl-1,2,3a,7a-tetrahydrobenzimidazole.
| Compound Name | 3-butyl-1,2,3a,7a-tetrahydrobenzimidazole |
|---|---|
| PubChem CID | 21479123 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 3-butyl-1,2,3a,7a-tetrahydrobenzimidazole |
| SMILES | CCCCN1CNC2C=CC=CC21 |
| InChI | InChI=1S/C11H18N2/c1-2-3-8-13-9-12-10-6-4-5-7-11(10)13/h4-7,10-12H,2-3,8-9H2,1H3 |
| InChIKey | UEOYPPGLMVREGP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |