C9H14N2O — CID 21479137
2-(2,3,3a,7a-tetrahydrobenzimidazol-1-yl)ethanol (PubChem CID 21479137) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-(2,3,3a,7a-tetrahydrobenzimidazol-1-yl)ethanol.
| Compound Name | 2-(2,3,3a,7a-tetrahydrobenzimidazol-1-yl)ethanol |
|---|---|
| PubChem CID | 21479137 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 2-(2,3,3a,7a-tetrahydrobenzimidazol-1-yl)ethanol |
| SMILES | OCCN1CNC2C=CC=CC21 |
| InChI | InChI=1S/C9H14N2O/c12-6-5-11-7-10-8-3-1-2-4-9(8)11/h1-4,8-10,12H,5-7H2 |
| InChIKey | MMFXSOZHRZZLRP-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |