C5H8N2O — CID 21479294
4-methyl-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 21479294) has the molecular formula C5H8N2O and a molecular weight of 112.13 g/mol. Its IUPAC name is 4-methyl-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | 4-methyl-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 21479294 |
| Molecular Formula | C5H8N2O |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.06 |
| IUPAC Name | 4-methyl-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | CC1C=NNC(=O)C1 |
| InChI | InChI=1S/C5H8N2O/c1-4-2-5(8)7-6-3-4/h3-4H,2H2,1H3,(H,7,8) |
| InChIKey | RWNZIIWZNOPSDB-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |