About 3,3-bis(ethenyl)dioxolane
3,3-bis(ethenyl)dioxolane (PubChem CID 21479542) has the molecular formula C7H10O2
and a molecular weight of 126.15 g/mol. Its IUPAC name is 3,3-bis(ethenyl)dioxolane.
Molecular Properties
| Compound Name | 3,3-bis(ethenyl)dioxolane |
| PubChem CID | 21479542 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | 3,3-bis(ethenyl)dioxolane |
| SMILES | C=CC1(C=C)CCOO1 |
| InChI | InChI=1S/C7H10O2/c1-3-7(4-2)5-6-8-9-7/h3-4H,1-2,5-6H2 |
| InChIKey | PYIANABVSQZUJI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3,3-bis(ethenyl)dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-bis(ethenyl)dioxolane?
The IUPAC name of 3,3-bis(ethenyl)dioxolane (CID 21479542) is 3,3-bis(ethenyl)dioxolane.
What is the SMILES notation for 3,3-bis(ethenyl)dioxolane?
The canonical SMILES for 3,3-bis(ethenyl)dioxolane is C=CC1(C=C)CCOO1.
What is the InChIKey of 3,3-bis(ethenyl)dioxolane?
The InChIKey is PYIANABVSQZUJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2/c1-3-7(4-2)5-6-8-9-7/h3-4H,1-2,5-6H2.
What are the key properties of 3,3-bis(ethenyl)dioxolane?
3,3-bis(ethenyl)dioxolane has a molecular weight of 126.15 g/mol, XLogP of 1.45, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-bis(ethenyl)dioxolane is sourced from PubChem (CID 21479542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).