About 6-(3,4-dichlorophenyl)-2-[4-(trifluoromethyl)phenyl]sulfonyl-4,5-dihydro-3H-pyridazine
6-(3,4-dichlorophenyl)-2-[4-(trifluoromethyl)phenyl]sulfonyl-4,5-dihydro-3H-pyridazine (PubChem CID 21479613) has the molecular formula C17H13Cl2F3N2O2S
and a molecular weight of 437.27 g/mol. Its IUPAC name is 6-(3,4-dichlorophenyl)-2-[4-(trifluoromethyl)phenyl]sulfonyl-4,5-dihydro-3H-pyridazine.
Molecular Properties
| Compound Name | 6-(3,4-dichlorophenyl)-2-[4-(trifluoromethyl)phenyl]sulfonyl-4,5-dihydro-3H-pyridazine |
| PubChem CID | 21479613 |
| Molecular Formula | C17H13Cl2F3N2O2S |
| Molecular Weight | 437.27 g/mol |
| Exact Mass | 436.00 |
| IUPAC Name | 6-(3,4-dichlorophenyl)-2-[4-(trifluoromethyl)phenyl]sulfonyl-4,5-dihydro-3H-pyridazine |
| SMILES | O=S(=O)(c1ccc(C(F)(F)F)cc1)N1CCCC(c2ccc(Cl)c(Cl)c2)=N1 |
| InChI | InChI=1S/C17H13Cl2F3N2O2S/c18-14-8-3-11(10-15(14)19)16-2-1-9-24(23-16)27(25,26)13-6-4-12(5-7-13)17(20,21)22/h3-8,10H,1-2,9H2 |
| InChIKey | ZLVYYPDWFCPZIK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.27 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(3,4-dichlorophenyl)-2-[4-(trifluoromethyl)phenyl]sulfonyl-4,5-dihydro-3H-pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,4-dichlorophenyl)-2-[4-(trifluoromethyl)phenyl]sulfonyl-4,5-dihydro-3H-pyridazine?
The IUPAC name of 6-(3,4-dichlorophenyl)-2-[4-(trifluoromethyl)phenyl]sulfonyl-4,5-dihydro-3H-pyridazine (CID 21479613) is 6-(3,4-dichlorophenyl)-2-[4-(trifluoromethyl)phenyl]sulfonyl-4,5-dihydro-3H-pyridazine.
What is the SMILES notation for 6-(3,4-dichlorophenyl)-2-[4-(trifluoromethyl)phenyl]sulfonyl-4,5-dihydro-3H-pyridazine?
The canonical SMILES for 6-(3,4-dichlorophenyl)-2-[4-(trifluoromethyl)phenyl]sulfonyl-4,5-dihydro-3H-pyridazine is O=S(=O)(c1ccc(C(F)(F)F)cc1)N1CCCC(c2ccc(Cl)c(Cl)c2)=N1.
What is the InChIKey of 6-(3,4-dichlorophenyl)-2-[4-(trifluoromethyl)phenyl]sulfonyl-4,5-dihydro-3H-pyridazine?
The InChIKey is ZLVYYPDWFCPZIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13Cl2F3N2O2S/c18-14-8-3-11(10-15(14)19)16-2-1-9-24(23-16)27(25,26)13-6-4-12(5-7-13)17(20,21)22/h3-8,10H,1-2,9H2.
What are the key properties of 6-(3,4-dichlorophenyl)-2-[4-(trifluoromethyl)phenyl]sulfonyl-4,5-dihydro-3H-pyridazine?
6-(3,4-dichlorophenyl)-2-[4-(trifluoromethyl)phenyl]sulfonyl-4,5-dihydro-3H-pyridazine has a molecular weight of 437.27 g/mol, XLogP of 5.20, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4-dichlorophenyl)-2-[4-(trifluoromethyl)phenyl]sulfonyl-4,5-dihydro-3H-pyridazine is sourced from PubChem (CID 21479613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).