About dicyclohexylmethanimine
dicyclohexylmethanimine (PubChem CID 21480220) has the molecular formula C13H23N
and a molecular weight of 193.33 g/mol. Its IUPAC name is dicyclohexylmethanimine.
Molecular Properties
| Compound Name | dicyclohexylmethanimine |
| PubChem CID | 21480220 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | dicyclohexylmethanimine |
| SMILES | [H]N=C(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C13H23N/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h11-12,14H,1-10H2 |
| InChIKey | ZESCEGHVCJPYES-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze dicyclohexylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyclohexylmethanimine?
The IUPAC name of dicyclohexylmethanimine (CID 21480220) is dicyclohexylmethanimine.
What is the SMILES notation for dicyclohexylmethanimine?
The canonical SMILES for dicyclohexylmethanimine is [H]N=C(C1CCCCC1)C1CCCCC1.
What is the InChIKey of dicyclohexylmethanimine?
The InChIKey is ZESCEGHVCJPYES-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h11-12,14H,1-10H2.
What are the key properties of dicyclohexylmethanimine?
dicyclohexylmethanimine has a molecular weight of 193.33 g/mol, XLogP of 4.17, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclohexylmethanimine is sourced from PubChem (CID 21480220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).