C28H31N2O3S- — CID 21480714
4-phenyl-1-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenylmethyl)piperidin-4-ol;(sulfinatoamino)methane (PubChem CID 21480714) has the molecular formula C28H31N2O3S- and a molecular weight of 475.63 g/mol. Its IUPAC name is 4-phenyl-1-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenylmethyl)piperidin-4-ol;(sulfinatoamino)methane.
| Compound Name | 4-phenyl-1-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenylmethyl)piperidin-4-ol;(sulfinatoamino)methane |
|---|---|
| PubChem CID | 21480714 |
| Molecular Formula | C28H31N2O3S- |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 4-phenyl-1-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenylmethyl)piperidin-4-ol;(sulfinatoamino)methane |
| SMILES | CNS(=O)[O-].OC1(c2ccccc2)CCN(CC23CC(c4ccccc42)c2ccccc23)CC1 |
| InChI | InChI=1S/C27H27NO.CH5NO2S/c29-27(20-8-2-1-3-9-20)14-16-28(17-15-27)19-26-18-23(21-10-4-6-12-24(21)26)22-11-5-7-13-25(22)26;1-2-5(3)4/h1-13,23,29H,14-19H2;2H,1H3,(H,3,4)/p-1 |
| InChIKey | YMMLGYDDHMJPSH-UHFFFAOYSA-M |
| XLogP | 3.81 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|