C13H9FN3O5S+ — CID 21480777
2-[1-[(6-fluoro-1,3-benzothiazol-2-yl)methyl]-2,4,5-trioxoimidazolidin-1-ium-1-yl]acetic acid (PubChem CID 21480777) has the molecular formula C13H9FN3O5S+ and a molecular weight of 338.30 g/mol. Its IUPAC name is 2-[1-[(6-fluoro-1,3-benzothiazol-2-yl)methyl]-2,4,5-trioxoimidazolidin-1-ium-1-yl]acetic acid.
| Compound Name | 2-[1-[(6-fluoro-1,3-benzothiazol-2-yl)methyl]-2,4,5-trioxoimidazolidin-1-ium-1-yl]acetic acid |
|---|---|
| PubChem CID | 21480777 |
| Molecular Formula | C13H9FN3O5S+ |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 2-[1-[(6-fluoro-1,3-benzothiazol-2-yl)methyl]-2,4,5-trioxoimidazolidin-1-ium-1-yl]acetic acid |
| SMILES | O=C(O)C[N+]1(Cc2nc3ccc(F)cc3s2)C(=O)NC(=O)C1=O |
| InChI | InChI=1S/C13H8FN3O5S/c14-6-1-2-7-8(3-6)23-9(15-7)4-17(5-10(18)19)12(21)11(20)16-13(17)22/h1-3H,4-5H2,(H-,16,18,19,20,22)/p+1 |
| InChIKey | FAPXDWZPHOEOSW-UHFFFAOYSA-O |
| XLogP | 0.61 |
| TPSA | 113.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|