C14H12N3O5S+ — CID 21480798
2-[1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]-2,4,5-trioxoimidazolidin-1-ium-1-yl]acetic acid (PubChem CID 21480798) has the molecular formula C14H12N3O5S+ and a molecular weight of 334.33 g/mol. Its IUPAC name is 2-[1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]-2,4,5-trioxoimidazolidin-1-ium-1-yl]acetic acid.
| Compound Name | 2-[1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]-2,4,5-trioxoimidazolidin-1-ium-1-yl]acetic acid |
|---|---|
| PubChem CID | 21480798 |
| Molecular Formula | C14H12N3O5S+ |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 2-[1-[(6-methyl-1,3-benzothiazol-2-yl)methyl]-2,4,5-trioxoimidazolidin-1-ium-1-yl]acetic acid |
| SMILES | Cc1ccc2nc(C[N+]3(CC(=O)O)C(=O)NC(=O)C3=O)sc2c1 |
| InChI | InChI=1S/C14H11N3O5S/c1-7-2-3-8-9(4-7)23-10(15-8)5-17(6-11(18)19)13(21)12(20)16-14(17)22/h2-4H,5-6H2,1H3,(H-,16,18,19,20,22)/p+1 |
| InChIKey | BHOVHGUABBAXDF-UHFFFAOYSA-O |
| XLogP | 0.78 |
| TPSA | 113.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|