C15H13FN3O5S+ — CID 21480810
2-[1-ethyl-3-[(6-fluoro-1,3-benzothiazol-2-yl)methyl]-2,4,5-trioxoimidazolidin-1-ium-1-yl]acetic acid (PubChem CID 21480810) has the molecular formula C15H13FN3O5S+ and a molecular weight of 366.35 g/mol. Its IUPAC name is 2-[1-ethyl-3-[(6-fluoro-1,3-benzothiazol-2-yl)methyl]-2,4,5-trioxoimidazolidin-1-ium-1-yl]acetic acid.
| Compound Name | 2-[1-ethyl-3-[(6-fluoro-1,3-benzothiazol-2-yl)methyl]-2,4,5-trioxoimidazolidin-1-ium-1-yl]acetic acid |
|---|---|
| PubChem CID | 21480810 |
| Molecular Formula | C15H13FN3O5S+ |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 2-[1-ethyl-3-[(6-fluoro-1,3-benzothiazol-2-yl)methyl]-2,4,5-trioxoimidazolidin-1-ium-1-yl]acetic acid |
| SMILES | CC[N+]1(CC(=O)O)C(=O)C(=O)N(Cc2nc3ccc(F)cc3s2)C1=O |
| InChI | InChI=1S/C15H12FN3O5S/c1-2-19(7-12(20)21)14(23)13(22)18(15(19)24)6-11-17-9-4-3-8(16)5-10(9)25-11/h3-5H,2,6-7H2,1H3/p+1 |
| InChIKey | FJIQJWMSPAIZNW-UHFFFAOYSA-O |
| XLogP | 1.35 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|