C16H18O4S — CID 21480883
2-(3,6-dihydroxy-2,4-dimethylphenyl)sulfanyl-3,5-dimethylbenzene-1,4-diol (PubChem CID 21480883) has the molecular formula C16H18O4S and a molecular weight of 306.38 g/mol. Its IUPAC name is 2-(3,6-dihydroxy-2,4-dimethylphenyl)sulfanyl-3,5-dimethylbenzene-1,4-diol.
| Compound Name | 2-(3,6-dihydroxy-2,4-dimethylphenyl)sulfanyl-3,5-dimethylbenzene-1,4-diol |
|---|---|
| PubChem CID | 21480883 |
| Molecular Formula | C16H18O4S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 2-(3,6-dihydroxy-2,4-dimethylphenyl)sulfanyl-3,5-dimethylbenzene-1,4-diol |
| SMILES | Cc1cc(O)c(Sc2c(O)cc(C)c(O)c2C)c(C)c1O |
| InChI | InChI=1S/C16H18O4S/c1-7-5-11(17)15(9(3)13(7)19)21-16-10(4)14(20)8(2)6-12(16)18/h5-6,17-20H,1-4H3 |
| InChIKey | HYQBOHGHOFKKEB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|