About 2-ethyl-3,4,5,6-tetramethylpyridine
2-ethyl-3,4,5,6-tetramethylpyridine (PubChem CID 21481160) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is 2-ethyl-3,4,5,6-tetramethylpyridine.
Molecular Properties
| Compound Name | 2-ethyl-3,4,5,6-tetramethylpyridine |
| PubChem CID | 21481160 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 2-ethyl-3,4,5,6-tetramethylpyridine |
| SMILES | CCc1nc(C)c(C)c(C)c1C |
| InChI | InChI=1S/C11H17N/c1-6-11-9(4)7(2)8(3)10(5)12-11/h6H2,1-5H3 |
| InChIKey | ZPDAUZYPDUDFKI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-3,4,5,6-tetramethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3,4,5,6-tetramethylpyridine?
The IUPAC name of 2-ethyl-3,4,5,6-tetramethylpyridine (CID 21481160) is 2-ethyl-3,4,5,6-tetramethylpyridine.
What is the SMILES notation for 2-ethyl-3,4,5,6-tetramethylpyridine?
The canonical SMILES for 2-ethyl-3,4,5,6-tetramethylpyridine is CCc1nc(C)c(C)c(C)c1C.
What is the InChIKey of 2-ethyl-3,4,5,6-tetramethylpyridine?
The InChIKey is ZPDAUZYPDUDFKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N/c1-6-11-9(4)7(2)8(3)10(5)12-11/h6H2,1-5H3.
What are the key properties of 2-ethyl-3,4,5,6-tetramethylpyridine?
2-ethyl-3,4,5,6-tetramethylpyridine has a molecular weight of 163.26 g/mol, XLogP of 2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3,4,5,6-tetramethylpyridine is sourced from PubChem (CID 21481160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).