About 2-acetyl-1,2,4-triazole-3-carboxamide
2-acetyl-1,2,4-triazole-3-carboxamide (PubChem CID 21481196) has the molecular formula C5H6N4O2
and a molecular weight of 154.13 g/mol. Its IUPAC name is 2-acetyl-1,2,4-triazole-3-carboxamide.
Molecular Properties
| Compound Name | 2-acetyl-1,2,4-triazole-3-carboxamide |
| PubChem CID | 21481196 |
| Molecular Formula | C5H6N4O2 |
| Molecular Weight | 154.13 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | 2-acetyl-1,2,4-triazole-3-carboxamide |
| SMILES | CC(=O)n1ncnc1C(N)=O |
| InChI | InChI=1S/C5H6N4O2/c1-3(10)9-5(4(6)11)7-2-8-9/h2H,1H3,(H2,6,11) |
| InChIKey | PIZRFGODGPBJMC-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.13 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-acetyl-1,2,4-triazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyl-1,2,4-triazole-3-carboxamide?
The IUPAC name of 2-acetyl-1,2,4-triazole-3-carboxamide (CID 21481196) is 2-acetyl-1,2,4-triazole-3-carboxamide.
What is the SMILES notation for 2-acetyl-1,2,4-triazole-3-carboxamide?
The canonical SMILES for 2-acetyl-1,2,4-triazole-3-carboxamide is CC(=O)n1ncnc1C(N)=O.
What is the InChIKey of 2-acetyl-1,2,4-triazole-3-carboxamide?
The InChIKey is PIZRFGODGPBJMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N4O2/c1-3(10)9-5(4(6)11)7-2-8-9/h2H,1H3,(H2,6,11).
What are the key properties of 2-acetyl-1,2,4-triazole-3-carboxamide?
2-acetyl-1,2,4-triazole-3-carboxamide has a molecular weight of 154.13 g/mol, XLogP of -0.96, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyl-1,2,4-triazole-3-carboxamide is sourced from PubChem (CID 21481196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).