About N,N'-dicyclohexylmethanediimine;ethynoxyethane
N,N'-dicyclohexylmethanediimine;ethynoxyethane (PubChem CID 21481424) has the molecular formula C17H28N2O
and a molecular weight of 276.42 g/mol. Its IUPAC name is N,N'-dicyclohexylmethanediimine;ethynoxyethane.
Molecular Properties
| Compound Name | N,N'-dicyclohexylmethanediimine;ethynoxyethane |
| PubChem CID | 21481424 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | N,N'-dicyclohexylmethanediimine;ethynoxyethane |
| SMILES | C#COCC.C(=NC1CCCCC1)=NC1CCCCC1 |
| InChI | InChI=1S/C13H22N2.C4H6O/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;1-3-5-4-2/h12-13H,1-10H2;1H,4H2,2H3 |
| InChIKey | WAAWUWVJQLVNKP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N'-dicyclohexylmethanediimine;ethynoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dicyclohexylmethanediimine;ethynoxyethane?
The IUPAC name of N,N'-dicyclohexylmethanediimine;ethynoxyethane (CID 21481424) is N,N'-dicyclohexylmethanediimine;ethynoxyethane.
What is the SMILES notation for N,N'-dicyclohexylmethanediimine;ethynoxyethane?
The canonical SMILES for N,N'-dicyclohexylmethanediimine;ethynoxyethane is C#COCC.C(=NC1CCCCC1)=NC1CCCCC1.
What is the InChIKey of N,N'-dicyclohexylmethanediimine;ethynoxyethane?
The InChIKey is WAAWUWVJQLVNKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2.C4H6O/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;1-3-5-4-2/h12-13H,1-10H2;1H,4H2,2H3.
What are the key properties of N,N'-dicyclohexylmethanediimine;ethynoxyethane?
N,N'-dicyclohexylmethanediimine;ethynoxyethane has a molecular weight of 276.42 g/mol, XLogP of 4.44, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dicyclohexylmethanediimine;ethynoxyethane is sourced from PubChem (CID 21481424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).