About 1-[2-[1-(3,4-dichlorophenyl)ethylsulfanyl]phenyl]imidazole
1-[2-[1-(3,4-dichlorophenyl)ethylsulfanyl]phenyl]imidazole (PubChem CID 21481637) has the molecular formula C17H14Cl2N2S
and a molecular weight of 349.29 g/mol. Its IUPAC name is 1-[2-[1-(3,4-dichlorophenyl)ethylsulfanyl]phenyl]imidazole.
Molecular Properties
| Compound Name | 1-[2-[1-(3,4-dichlorophenyl)ethylsulfanyl]phenyl]imidazole |
| PubChem CID | 21481637 |
| Molecular Formula | C17H14Cl2N2S |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 1-[2-[1-(3,4-dichlorophenyl)ethylsulfanyl]phenyl]imidazole |
| SMILES | CC(Sc1ccccc1-n1ccnc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H14Cl2N2S/c1-12(13-6-7-14(18)15(19)10-13)22-17-5-3-2-4-16(17)21-9-8-20-11-21/h2-12H,1H3 |
| InChIKey | UDSACDAQHKAGNE-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-[1-(3,4-dichlorophenyl)ethylsulfanyl]phenyl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[1-(3,4-dichlorophenyl)ethylsulfanyl]phenyl]imidazole?
The IUPAC name of 1-[2-[1-(3,4-dichlorophenyl)ethylsulfanyl]phenyl]imidazole (CID 21481637) is 1-[2-[1-(3,4-dichlorophenyl)ethylsulfanyl]phenyl]imidazole.
What is the SMILES notation for 1-[2-[1-(3,4-dichlorophenyl)ethylsulfanyl]phenyl]imidazole?
The canonical SMILES for 1-[2-[1-(3,4-dichlorophenyl)ethylsulfanyl]phenyl]imidazole is CC(Sc1ccccc1-n1ccnc1)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 1-[2-[1-(3,4-dichlorophenyl)ethylsulfanyl]phenyl]imidazole?
The InChIKey is UDSACDAQHKAGNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14Cl2N2S/c1-12(13-6-7-14(18)15(19)10-13)22-17-5-3-2-4-16(17)21-9-8-20-11-21/h2-12H,1H3.
What are the key properties of 1-[2-[1-(3,4-dichlorophenyl)ethylsulfanyl]phenyl]imidazole?
1-[2-[1-(3,4-dichlorophenyl)ethylsulfanyl]phenyl]imidazole has a molecular weight of 349.29 g/mol, XLogP of 6.03, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[1-(3,4-dichlorophenyl)ethylsulfanyl]phenyl]imidazole is sourced from PubChem (CID 21481637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).