C13H13FN2O3S — CID 2148177
2-(3,5-dioxothiomorpholin-4-yl)-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 2148177) has the molecular formula C13H13FN2O3S and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-(3,5-dioxothiomorpholin-4-yl)-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | 2-(3,5-dioxothiomorpholin-4-yl)-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 2148177 |
| Molecular Formula | C13H13FN2O3S |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 2-(3,5-dioxothiomorpholin-4-yl)-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | O=C(CN1C(=O)CSCC1=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C13H13FN2O3S/c14-10-3-1-9(2-4-10)5-15-11(17)6-16-12(18)7-20-8-13(16)19/h1-4H,5-8H2,(H,15,17) |
| InChIKey | MIVJMXMFZJQHJH-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|