About 5-(4-methoxy-N-(4-methoxyphenyl)anilino)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one
5-(4-methoxy-N-(4-methoxyphenyl)anilino)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 21481815) has the molecular formula C24H23NO3
and a molecular weight of 373.45 g/mol. Its IUPAC name is 5-(4-methoxy-N-(4-methoxyphenyl)anilino)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
Molecular Properties
| Compound Name | 5-(4-methoxy-N-(4-methoxyphenyl)anilino)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| PubChem CID | 21481815 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 5-(4-methoxy-N-(4-methoxyphenyl)anilino)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | COc1ccc(N(C2=CC(=O)C3C4C=CC(C4)C23)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H23NO3/c1-27-19-9-5-17(6-10-19)25(18-7-11-20(28-2)12-8-18)21-14-22(26)24-16-4-3-15(13-16)23(21)24/h3-12,14-16,23-24H,13H2,1-2H3 |
| InChIKey | SJVOBDMCJBRHIL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-methoxy-N-(4-methoxyphenyl)anilino)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methoxy-N-(4-methoxyphenyl)anilino)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one?
The IUPAC name of 5-(4-methoxy-N-(4-methoxyphenyl)anilino)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one (CID 21481815) is 5-(4-methoxy-N-(4-methoxyphenyl)anilino)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
What is the SMILES notation for 5-(4-methoxy-N-(4-methoxyphenyl)anilino)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one?
The canonical SMILES for 5-(4-methoxy-N-(4-methoxyphenyl)anilino)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one is COc1ccc(N(C2=CC(=O)C3C4C=CC(C4)C23)c2ccc(OC)cc2)cc1.
What is the InChIKey of 5-(4-methoxy-N-(4-methoxyphenyl)anilino)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one?
The InChIKey is SJVOBDMCJBRHIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23NO3/c1-27-19-9-5-17(6-10-19)25(18-7-11-20(28-2)12-8-18)21-14-22(26)24-16-4-3-15(13-16)23(21)24/h3-12,14-16,23-24H,13H2,1-2H3.
What are the key properties of 5-(4-methoxy-N-(4-methoxyphenyl)anilino)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one?
5-(4-methoxy-N-(4-methoxyphenyl)anilino)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one has a molecular weight of 373.45 g/mol, XLogP of 4.75, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methoxy-N-(4-methoxyphenyl)anilino)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one is sourced from PubChem (CID 21481815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).