C21H23Cl3N4O3S — CID 21481859
[3-(5-cycloheptyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 3,4,5-trichlorobenzoate (PubChem CID 21481859) has the molecular formula C21H23Cl3N4O3S and a molecular weight of 517.87 g/mol. Its IUPAC name is [3-(5-cycloheptyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 3,4,5-trichlorobenzoate.
| Compound Name | [3-(5-cycloheptyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 3,4,5-trichlorobenzoate |
|---|---|
| PubChem CID | 21481859 |
| Molecular Formula | C21H23Cl3N4O3S |
| Molecular Weight | 517.87 g/mol |
| Exact Mass | 516.06 |
| IUPAC Name | [3-(5-cycloheptyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 3,4,5-trichlorobenzoate |
| SMILES | CN1CCC(OC(=O)c2cc(Cl)c(Cl)c(Cl)c2)N(c2nnc(C3CCCCCC3)s2)C1=O |
| InChI | InChI=1S/C21H23Cl3N4O3S/c1-27-9-8-16(31-19(29)13-10-14(22)17(24)15(23)11-13)28(21(27)30)20-26-25-18(32-20)12-6-4-2-3-5-7-12/h10-12,16H,2-9H2,1H3 |
| InChIKey | USSPUALDLKYUMS-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.87 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|