C17H17IN4O3S — CID 21481886
[3-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 4-iodobenzoate (PubChem CID 21481886) has the molecular formula C17H17IN4O3S and a molecular weight of 484.32 g/mol. Its IUPAC name is [3-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 4-iodobenzoate.
| Compound Name | [3-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 4-iodobenzoate |
|---|---|
| PubChem CID | 21481886 |
| Molecular Formula | C17H17IN4O3S |
| Molecular Weight | 484.32 g/mol |
| Exact Mass | 484.01 |
| IUPAC Name | [3-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 4-iodobenzoate |
| SMILES | CN1CCC(OC(=O)c2ccc(I)cc2)N(c2nnc(C3CC3)s2)C1=O |
| InChI | InChI=1S/C17H17IN4O3S/c1-21-9-8-13(25-15(23)11-4-6-12(18)7-5-11)22(17(21)24)16-20-19-14(26-16)10-2-3-10/h4-7,10,13H,2-3,8-9H2,1H3 |
| InChIKey | VHDSXRYQZLANMM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|