C26H36N4O3S — CID 21481906
[3-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 4-hexylbenzoate (PubChem CID 21481906) has the molecular formula C26H36N4O3S and a molecular weight of 484.67 g/mol. Its IUPAC name is [3-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 4-hexylbenzoate.
| Compound Name | [3-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 4-hexylbenzoate |
|---|---|
| PubChem CID | 21481906 |
| Molecular Formula | C26H36N4O3S |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | [3-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 4-hexylbenzoate |
| SMILES | CCCCCCc1ccc(C(=O)OC2CCN(C)C(=O)N2c2nnc(C3CCCCC3)s2)cc1 |
| InChI | InChI=1S/C26H36N4O3S/c1-3-4-5-7-10-19-13-15-21(16-14-19)24(31)33-22-17-18-29(2)26(32)30(22)25-28-27-23(34-25)20-11-8-6-9-12-20/h13-16,20,22H,3-12,17-18H2,1-2H3 |
| InChIKey | MGEAJFRJEYJCHZ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|