About methyl N-[N,N'-dimethyl-N-(propan-2-ylcarbamoyl)carbamimidoyl]-N-methylcarbamate
methyl N-[N,N'-dimethyl-N-(propan-2-ylcarbamoyl)carbamimidoyl]-N-methylcarbamate (PubChem CID 21481935) has the molecular formula C10H20N4O3
and a molecular weight of 244.29 g/mol. Its IUPAC name is methyl N-[N,N'-dimethyl-N-(propan-2-ylcarbamoyl)carbamimidoyl]-N-methylcarbamate.
Molecular Properties
| Compound Name | methyl N-[N,N'-dimethyl-N-(propan-2-ylcarbamoyl)carbamimidoyl]-N-methylcarbamate |
| PubChem CID | 21481935 |
| Molecular Formula | C10H20N4O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | methyl N-[N,N'-dimethyl-N-(propan-2-ylcarbamoyl)carbamimidoyl]-N-methylcarbamate |
| SMILES | C/N=C(/N(C)C(=O)NC(C)C)N(C)C(=O)OC |
| InChI | InChI=1S/C10H20N4O3/c1-7(2)12-9(15)13(4)8(11-3)14(5)10(16)17-6/h7H,1-6H3,(H,12,15)/b11-8- |
| InChIKey | XKFCCULCUMOAHT-FLIBITNWSA-N |
| XLogP | 0.72 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[N,N'-dimethyl-N-(propan-2-ylcarbamoyl)carbamimidoyl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[N,N'-dimethyl-N-(propan-2-ylcarbamoyl)carbamimidoyl]-N-methylcarbamate?
The IUPAC name of methyl N-[N,N'-dimethyl-N-(propan-2-ylcarbamoyl)carbamimidoyl]-N-methylcarbamate (CID 21481935) is methyl N-[N,N'-dimethyl-N-(propan-2-ylcarbamoyl)carbamimidoyl]-N-methylcarbamate.
What is the SMILES notation for methyl N-[N,N'-dimethyl-N-(propan-2-ylcarbamoyl)carbamimidoyl]-N-methylcarbamate?
The canonical SMILES for methyl N-[N,N'-dimethyl-N-(propan-2-ylcarbamoyl)carbamimidoyl]-N-methylcarbamate is C/N=C(/N(C)C(=O)NC(C)C)N(C)C(=O)OC.
What is the InChIKey of methyl N-[N,N'-dimethyl-N-(propan-2-ylcarbamoyl)carbamimidoyl]-N-methylcarbamate?
The InChIKey is XKFCCULCUMOAHT-FLIBITNWSA-N. The full InChI is InChI=1S/C10H20N4O3/c1-7(2)12-9(15)13(4)8(11-3)14(5)10(16)17-6/h7H,1-6H3,(H,12,15)/b11-8-.
What are the key properties of methyl N-[N,N'-dimethyl-N-(propan-2-ylcarbamoyl)carbamimidoyl]-N-methylcarbamate?
methyl N-[N,N'-dimethyl-N-(propan-2-ylcarbamoyl)carbamimidoyl]-N-methylcarbamate has a molecular weight of 244.29 g/mol, XLogP of 0.72, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[N,N'-dimethyl-N-(propan-2-ylcarbamoyl)carbamimidoyl]-N-methylcarbamate is sourced from PubChem (CID 21481935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).