About 3-piperidin-1-ylpropyl 2-cyclohexylidene-2-thiophen-3-ylacetate;hydrochloride
3-piperidin-1-ylpropyl 2-cyclohexylidene-2-thiophen-3-ylacetate;hydrochloride (PubChem CID 21482221) has the molecular formula C20H30ClNO2S
and a molecular weight of 383.99 g/mol. Its IUPAC name is 3-piperidin-1-ylpropyl 2-cyclohexylidene-2-thiophen-3-ylacetate;hydrochloride.
Molecular Properties
| Compound Name | 3-piperidin-1-ylpropyl 2-cyclohexylidene-2-thiophen-3-ylacetate;hydrochloride |
| PubChem CID | 21482221 |
| Molecular Formula | C20H30ClNO2S |
| Molecular Weight | 383.99 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 3-piperidin-1-ylpropyl 2-cyclohexylidene-2-thiophen-3-ylacetate;hydrochloride |
| SMILES | Cl.O=C(OCCCN1CCCCC1)C(=C1CCCCC1)c1ccsc1 |
| InChI | InChI=1S/C20H29NO2S.ClH/c22-20(23-14-7-13-21-11-5-2-6-12-21)19(18-10-15-24-16-18)17-8-3-1-4-9-17;/h10,15-16H,1-9,11-14H2;1H |
| InChIKey | FCFZLZNOVBUGRW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.99 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-piperidin-1-ylpropyl 2-cyclohexylidene-2-thiophen-3-ylacetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-piperidin-1-ylpropyl 2-cyclohexylidene-2-thiophen-3-ylacetate;hydrochloride?
The IUPAC name of 3-piperidin-1-ylpropyl 2-cyclohexylidene-2-thiophen-3-ylacetate;hydrochloride (CID 21482221) is 3-piperidin-1-ylpropyl 2-cyclohexylidene-2-thiophen-3-ylacetate;hydrochloride.
What is the SMILES notation for 3-piperidin-1-ylpropyl 2-cyclohexylidene-2-thiophen-3-ylacetate;hydrochloride?
The canonical SMILES for 3-piperidin-1-ylpropyl 2-cyclohexylidene-2-thiophen-3-ylacetate;hydrochloride is Cl.O=C(OCCCN1CCCCC1)C(=C1CCCCC1)c1ccsc1.
What is the InChIKey of 3-piperidin-1-ylpropyl 2-cyclohexylidene-2-thiophen-3-ylacetate;hydrochloride?
The InChIKey is FCFZLZNOVBUGRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29NO2S.ClH/c22-20(23-14-7-13-21-11-5-2-6-12-21)19(18-10-15-24-16-18)17-8-3-1-4-9-17;/h10,15-16H,1-9,11-14H2;1H.
What are the key properties of 3-piperidin-1-ylpropyl 2-cyclohexylidene-2-thiophen-3-ylacetate;hydrochloride?
3-piperidin-1-ylpropyl 2-cyclohexylidene-2-thiophen-3-ylacetate;hydrochloride has a molecular weight of 383.99 g/mol, XLogP of 5.31, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperidin-1-ylpropyl 2-cyclohexylidene-2-thiophen-3-ylacetate;hydrochloride is sourced from PubChem (CID 21482221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).