C16H23Cl2NO — CID 21482392
1-[3-(4-chlorophenyl)-5-cyclopropyl-2-methylpyrrolidin-1-yl]ethanol;hydrochloride (PubChem CID 21482392) has the molecular formula C16H23Cl2NO and a molecular weight of 316.27 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)-5-cyclopropyl-2-methylpyrrolidin-1-yl]ethanol;hydrochloride.
| Compound Name | 1-[3-(4-chlorophenyl)-5-cyclopropyl-2-methylpyrrolidin-1-yl]ethanol;hydrochloride |
|---|---|
| PubChem CID | 21482392 |
| Molecular Formula | C16H23Cl2NO |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 1-[3-(4-chlorophenyl)-5-cyclopropyl-2-methylpyrrolidin-1-yl]ethanol;hydrochloride |
| SMILES | CC(O)N1C(C)C(c2ccc(Cl)cc2)CC1C1CC1.Cl |
| InChI | InChI=1S/C16H22ClNO.ClH/c1-10-15(12-5-7-14(17)8-6-12)9-16(13-3-4-13)18(10)11(2)19;/h5-8,10-11,13,15-16,19H,3-4,9H2,1-2H3;1H |
| InChIKey | QUEYFEBFRYFZCB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |