C16H26O2 — CID 21482422
3-methyl-3,4,5,6,7,8,9,10,11,12,13,14-dodecahydrocyclododeca[b]pyran-2-one (PubChem CID 21482422) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 3-methyl-3,4,5,6,7,8,9,10,11,12,13,14-dodecahydrocyclododeca[b]pyran-2-one.
| Compound Name | 3-methyl-3,4,5,6,7,8,9,10,11,12,13,14-dodecahydrocyclododeca[b]pyran-2-one |
|---|---|
| PubChem CID | 21482422 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 3-methyl-3,4,5,6,7,8,9,10,11,12,13,14-dodecahydrocyclododeca[b]pyran-2-one |
| SMILES | CC1CC2=C(CCCCCCCCCC2)OC1=O |
| InChI | InChI=1S/C16H26O2/c1-13-12-14-10-8-6-4-2-3-5-7-9-11-15(14)18-16(13)17/h13H,2-12H2,1H3 |
| InChIKey | JCSJUJPFQBUIDN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |