C30H54 — CID 21482675
1,2,3,4,5,6-hexa(butan-2-yl)benzene (PubChem CID 21482675) has the molecular formula C30H54 and a molecular weight of 414.76 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexa(butan-2-yl)benzene.
| Compound Name | 1,2,3,4,5,6-hexa(butan-2-yl)benzene |
|---|---|
| PubChem CID | 21482675 |
| Molecular Formula | C30H54 |
| Molecular Weight | 414.76 g/mol |
| Exact Mass | 414.42 |
| IUPAC Name | 1,2,3,4,5,6-hexa(butan-2-yl)benzene |
| SMILES | CCC(C)c1c(C(C)CC)c(C(C)CC)c(C(C)CC)c(C(C)CC)c1C(C)CC |
| InChI | InChI=1S/C30H54/c1-13-19(7)25-26(20(8)14-2)28(22(10)16-4)30(24(12)18-6)29(23(11)17-5)27(25)21(9)15-3/h19-24H,13-18H2,1-12H3 |
| InChIKey | XPLXRRXHBUAMLP-UHFFFAOYSA-N |
| XLogP | 10.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.76 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |