About 9H-xanthen-9-yl N-methylcarbamate
9H-xanthen-9-yl N-methylcarbamate (PubChem CID 21482819) has the molecular formula C15H13NO3
and a molecular weight of 255.27 g/mol. Its IUPAC name is 9H-xanthen-9-yl N-methylcarbamate.
Molecular Properties
| Compound Name | 9H-xanthen-9-yl N-methylcarbamate |
| PubChem CID | 21482819 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 9H-xanthen-9-yl N-methylcarbamate |
| SMILES | CNC(=O)OC1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C15H13NO3/c1-16-15(17)19-14-10-6-2-4-8-12(10)18-13-9-5-3-7-11(13)14/h2-9,14H,1H3,(H,16,17) |
| InChIKey | QGWSWIDXWJKYCU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9H-xanthen-9-yl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-xanthen-9-yl N-methylcarbamate?
The IUPAC name of 9H-xanthen-9-yl N-methylcarbamate (CID 21482819) is 9H-xanthen-9-yl N-methylcarbamate.
What is the SMILES notation for 9H-xanthen-9-yl N-methylcarbamate?
The canonical SMILES for 9H-xanthen-9-yl N-methylcarbamate is CNC(=O)OC1c2ccccc2Oc2ccccc21.
What is the InChIKey of 9H-xanthen-9-yl N-methylcarbamate?
The InChIKey is QGWSWIDXWJKYCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO3/c1-16-15(17)19-14-10-6-2-4-8-12(10)18-13-9-5-3-7-11(13)14/h2-9,14H,1H3,(H,16,17).
What are the key properties of 9H-xanthen-9-yl N-methylcarbamate?
9H-xanthen-9-yl N-methylcarbamate has a molecular weight of 255.27 g/mol, XLogP of 3.24, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-xanthen-9-yl N-methylcarbamate is sourced from PubChem (CID 21482819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).