About 3,3-diethoxypiperidine
3,3-diethoxypiperidine (PubChem CID 21482822) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is 3,3-diethoxypiperidine.
Molecular Properties
| Compound Name | 3,3-diethoxypiperidine |
| PubChem CID | 21482822 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | 3,3-diethoxypiperidine |
| SMILES | CCOC1(OCC)CCCNC1 |
| InChI | InChI=1S/C9H19NO2/c1-3-11-9(12-4-2)6-5-7-10-8-9/h10H,3-8H2,1-2H3 |
| InChIKey | SHNLHJWRMUFFDN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3,3-diethoxypiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diethoxypiperidine?
The IUPAC name of 3,3-diethoxypiperidine (CID 21482822) is 3,3-diethoxypiperidine.
What is the SMILES notation for 3,3-diethoxypiperidine?
The canonical SMILES for 3,3-diethoxypiperidine is CCOC1(OCC)CCCNC1.
What is the InChIKey of 3,3-diethoxypiperidine?
The InChIKey is SHNLHJWRMUFFDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2/c1-3-11-9(12-4-2)6-5-7-10-8-9/h10H,3-8H2,1-2H3.
What are the key properties of 3,3-diethoxypiperidine?
3,3-diethoxypiperidine has a molecular weight of 173.26 g/mol, XLogP of 1.14, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diethoxypiperidine is sourced from PubChem (CID 21482822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).