C27H37N3O2 — CID 21482833
N,N-dibutyl-3-(9H-xanthen-9-ylamino)piperidine-1-carboxamide (PubChem CID 21482833) has the molecular formula C27H37N3O2 and a molecular weight of 435.61 g/mol. Its IUPAC name is N,N-dibutyl-3-(9H-xanthen-9-ylamino)piperidine-1-carboxamide.
| Compound Name | N,N-dibutyl-3-(9H-xanthen-9-ylamino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 21482833 |
| Molecular Formula | C27H37N3O2 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | N,N-dibutyl-3-(9H-xanthen-9-ylamino)piperidine-1-carboxamide |
| SMILES | CCCCN(CCCC)C(=O)N1CCCC(NC2c3ccccc3Oc3ccccc32)C1 |
| InChI | InChI=1S/C27H37N3O2/c1-3-5-17-29(18-6-4-2)27(31)30-19-11-12-21(20-30)28-26-22-13-7-9-15-24(22)32-25-16-10-8-14-23(25)26/h7-10,13-16,21,26,28H,3-6,11-12,17-20H2,1-2H3 |
| InChIKey | VHNSHTBVFXASMJ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |