About ethyl N-[[2-[(2-morpholin-4-ylacetyl)amino]phenyl]carbamothioyl]carbamate;hydrochloride
ethyl N-[[2-[(2-morpholin-4-ylacetyl)amino]phenyl]carbamothioyl]carbamate;hydrochloride (PubChem CID 21482986) has the molecular formula C16H23ClN4O4S
and a molecular weight of 402.90 g/mol. Its IUPAC name is ethyl N-[[2-[(2-morpholin-4-ylacetyl)amino]phenyl]carbamothioyl]carbamate;hydrochloride.
Molecular Properties
| Compound Name | ethyl N-[[2-[(2-morpholin-4-ylacetyl)amino]phenyl]carbamothioyl]carbamate;hydrochloride |
| PubChem CID | 21482986 |
| Molecular Formula | C16H23ClN4O4S |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | ethyl N-[[2-[(2-morpholin-4-ylacetyl)amino]phenyl]carbamothioyl]carbamate;hydrochloride |
| SMILES | CCOC(=O)NC(=S)Nc1ccccc1NC(=O)CN1CCOCC1.Cl |
| InChI | InChI=1S/C16H22N4O4S.ClH/c1-2-24-16(22)19-15(25)18-13-6-4-3-5-12(13)17-14(21)11-20-7-9-23-10-8-20;/h3-6H,2,7-11H2,1H3,(H,17,21)(H2,18,19,22,25);1H |
| InChIKey | IPJNXGNGCKFREO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[[2-[(2-morpholin-4-ylacetyl)amino]phenyl]carbamothioyl]carbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[[2-[(2-morpholin-4-ylacetyl)amino]phenyl]carbamothioyl]carbamate;hydrochloride?
The IUPAC name of ethyl N-[[2-[(2-morpholin-4-ylacetyl)amino]phenyl]carbamothioyl]carbamate;hydrochloride (CID 21482986) is ethyl N-[[2-[(2-morpholin-4-ylacetyl)amino]phenyl]carbamothioyl]carbamate;hydrochloride.
What is the SMILES notation for ethyl N-[[2-[(2-morpholin-4-ylacetyl)amino]phenyl]carbamothioyl]carbamate;hydrochloride?
The canonical SMILES for ethyl N-[[2-[(2-morpholin-4-ylacetyl)amino]phenyl]carbamothioyl]carbamate;hydrochloride is CCOC(=O)NC(=S)Nc1ccccc1NC(=O)CN1CCOCC1.Cl.
What is the InChIKey of ethyl N-[[2-[(2-morpholin-4-ylacetyl)amino]phenyl]carbamothioyl]carbamate;hydrochloride?
The InChIKey is IPJNXGNGCKFREO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4O4S.ClH/c1-2-24-16(22)19-15(25)18-13-6-4-3-5-12(13)17-14(21)11-20-7-9-23-10-8-20;/h3-6H,2,7-11H2,1H3,(H,17,21)(H2,18,19,22,25);1H.
What are the key properties of ethyl N-[[2-[(2-morpholin-4-ylacetyl)amino]phenyl]carbamothioyl]carbamate;hydrochloride?
ethyl N-[[2-[(2-morpholin-4-ylacetyl)amino]phenyl]carbamothioyl]carbamate;hydrochloride has a molecular weight of 402.90 g/mol, XLogP of 1.82, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[[2-[(2-morpholin-4-ylacetyl)amino]phenyl]carbamothioyl]carbamate;hydrochloride is sourced from PubChem (CID 21482986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).