C17H20N2O5S — CID 2148327
N-(1,3-benzodioxol-5-yl)-2-[(2R,6R)-2,6-diethyl-3,5-dioxothiomorpholin-4-yl]acetamide (PubChem CID 2148327) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[(2R,6R)-2,6-diethyl-3,5-dioxothiomorpholin-4-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[(2R,6R)-2,6-diethyl-3,5-dioxothiomorpholin-4-yl]acetamide |
|---|---|
| PubChem CID | 2148327 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[(2R,6R)-2,6-diethyl-3,5-dioxothiomorpholin-4-yl]acetamide |
| SMILES | CC[C@H]1S[C@H](CC)C(=O)N(CC(=O)Nc2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C17H20N2O5S/c1-3-13-16(21)19(17(22)14(4-2)25-13)8-15(20)18-10-5-6-11-12(7-10)24-9-23-11/h5-7,13-14H,3-4,8-9H2,1-2H3,(H,18,20)/t13-,14-/m1/s1 |
| InChIKey | CSQQBEMRVOAXTG-ZIAGYGMSSA-N |
| XLogP | 2.01 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|