C22H27BrN2 — CID 21483802
3-[(7-bromo-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)amino]-N,N-diethylpropan-1-amine (PubChem CID 21483802) has the molecular formula C22H27BrN2 and a molecular weight of 399.38 g/mol. Its IUPAC name is 3-[(7-bromo-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)amino]-N,N-diethylpropan-1-amine.
| Compound Name | 3-[(7-bromo-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)amino]-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 21483802 |
| Molecular Formula | C22H27BrN2 |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 3-[(7-bromo-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)amino]-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CCC/N=C1\c2ccccc2CCc2c(Br)cccc21 |
| InChI | InChI=1S/C22H27BrN2/c1-3-25(4-2)16-8-15-24-22-18-10-6-5-9-17(18)13-14-19-20(22)11-7-12-21(19)23/h5-7,9-12H,3-4,8,13-16H2,1-2H3/b24-22+ |
| InChIKey | IWYYLUFNVGZCSQ-ZNTNEXAZSA-N |
| XLogP | 5.12 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|