C22H27N3O — CID 21483830
2-[2-(dimethylamino)ethylimino]-N,N-dimethyltricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene-5-carboxamide (PubChem CID 21483830) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethylimino]-N,N-dimethyltricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene-5-carboxamide.
| Compound Name | 2-[2-(dimethylamino)ethylimino]-N,N-dimethyltricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 21483830 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 2-[2-(dimethylamino)ethylimino]-N,N-dimethyltricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene-5-carboxamide |
| SMILES | CN(C)CC/N=C1\c2ccccc2CCc2ccc(C(=O)N(C)C)cc21 |
| InChI | InChI=1S/C22H27N3O/c1-24(2)14-13-23-21-19-8-6-5-7-16(19)9-10-17-11-12-18(15-20(17)21)22(26)25(3)4/h5-8,11-12,15H,9-10,13-14H2,1-4H3/b23-21+ |
| InChIKey | OCKKYJJSHYRCQC-XTQSDGFTSA-N |
| XLogP | 2.89 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|