About 4-chloro-2,6-dinitroaniline
4-chloro-2,6-dinitroaniline (PubChem CID 21484) has the molecular formula C6H4ClN3O4
and a molecular weight of 217.57 g/mol. Its IUPAC name is 4-chloro-2,6-dinitroaniline.
Molecular Properties
| Compound Name | 4-chloro-2,6-dinitroaniline |
| PubChem CID | 21484 |
| Molecular Formula | C6H4ClN3O4 |
| Molecular Weight | 217.57 g/mol |
| Exact Mass | 216.99 |
| IUPAC Name | 4-chloro-2,6-dinitroaniline |
| SMILES | Nc1c([N+](=O)[O-])cc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H4ClN3O4/c7-3-1-4(9(11)12)6(8)5(2-3)10(13)14/h1-2H,8H2 |
| InChIKey | CLMQUEQFVUMDPC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.57 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2,6-dinitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2,6-dinitroaniline?
The IUPAC name of 4-chloro-2,6-dinitroaniline (CID 21484) is 4-chloro-2,6-dinitroaniline.
What is the SMILES notation for 4-chloro-2,6-dinitroaniline?
The canonical SMILES for 4-chloro-2,6-dinitroaniline is Nc1c([N+](=O)[O-])cc(Cl)cc1[N+](=O)[O-].
What is the InChIKey of 4-chloro-2,6-dinitroaniline?
The InChIKey is CLMQUEQFVUMDPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClN3O4/c7-3-1-4(9(11)12)6(8)5(2-3)10(13)14/h1-2H,8H2.
What are the key properties of 4-chloro-2,6-dinitroaniline?
4-chloro-2,6-dinitroaniline has a molecular weight of 217.57 g/mol, XLogP of 1.74, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2,6-dinitroaniline is sourced from PubChem (CID 21484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).