About 1,2-dihydropyridine-2,6-diamine
1,2-dihydropyridine-2,6-diamine (PubChem CID 21484149) has the molecular formula C5H9N3
and a molecular weight of 111.15 g/mol. Its IUPAC name is 1,2-dihydropyridine-2,6-diamine.
Molecular Properties
| Compound Name | 1,2-dihydropyridine-2,6-diamine |
| PubChem CID | 21484149 |
| Molecular Formula | C5H9N3 |
| Molecular Weight | 111.15 g/mol |
| Exact Mass | 111.08 |
| IUPAC Name | 1,2-dihydropyridine-2,6-diamine |
| SMILES | NC1=CC=CC(N)N1 |
| InChI | InChI=1S/C5H9N3/c6-4-2-1-3-5(7)8-4/h1-4,8H,6-7H2 |
| InChIKey | XNJATKPGORTUCP-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.15 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2-dihydropyridine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydropyridine-2,6-diamine?
The IUPAC name of 1,2-dihydropyridine-2,6-diamine (CID 21484149) is 1,2-dihydropyridine-2,6-diamine.
What is the SMILES notation for 1,2-dihydropyridine-2,6-diamine?
The canonical SMILES for 1,2-dihydropyridine-2,6-diamine is NC1=CC=CC(N)N1.
What is the InChIKey of 1,2-dihydropyridine-2,6-diamine?
The InChIKey is XNJATKPGORTUCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3/c6-4-2-1-3-5(7)8-4/h1-4,8H,6-7H2.
What are the key properties of 1,2-dihydropyridine-2,6-diamine?
1,2-dihydropyridine-2,6-diamine has a molecular weight of 111.15 g/mol, XLogP of -0.77, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydropyridine-2,6-diamine is sourced from PubChem (CID 21484149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).