About 2-methylbut-3-en-2-yl (3-methyl-3-propan-2-ylcyclohexyl) carbonate
2-methylbut-3-en-2-yl (3-methyl-3-propan-2-ylcyclohexyl) carbonate (PubChem CID 21484555) has the molecular formula C16H28O3
and a molecular weight of 268.40 g/mol. Its IUPAC name is 2-methylbut-3-en-2-yl (3-methyl-3-propan-2-ylcyclohexyl) carbonate.
Molecular Properties
| Compound Name | 2-methylbut-3-en-2-yl (3-methyl-3-propan-2-ylcyclohexyl) carbonate |
| PubChem CID | 21484555 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 2-methylbut-3-en-2-yl (3-methyl-3-propan-2-ylcyclohexyl) carbonate |
| SMILES | C=CC(C)(C)OC(=O)OC1CCCC(C)(C(C)C)C1 |
| InChI | InChI=1S/C16H28O3/c1-7-15(4,5)19-14(17)18-13-9-8-10-16(6,11-13)12(2)3/h7,12-13H,1,8-11H2,2-6H3 |
| InChIKey | CSVNBVSYHJNIGR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbut-3-en-2-yl (3-methyl-3-propan-2-ylcyclohexyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbut-3-en-2-yl (3-methyl-3-propan-2-ylcyclohexyl) carbonate?
The IUPAC name of 2-methylbut-3-en-2-yl (3-methyl-3-propan-2-ylcyclohexyl) carbonate (CID 21484555) is 2-methylbut-3-en-2-yl (3-methyl-3-propan-2-ylcyclohexyl) carbonate.
What is the SMILES notation for 2-methylbut-3-en-2-yl (3-methyl-3-propan-2-ylcyclohexyl) carbonate?
The canonical SMILES for 2-methylbut-3-en-2-yl (3-methyl-3-propan-2-ylcyclohexyl) carbonate is C=CC(C)(C)OC(=O)OC1CCCC(C)(C(C)C)C1.
What is the InChIKey of 2-methylbut-3-en-2-yl (3-methyl-3-propan-2-ylcyclohexyl) carbonate?
The InChIKey is CSVNBVSYHJNIGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O3/c1-7-15(4,5)19-14(17)18-13-9-8-10-16(6,11-13)12(2)3/h7,12-13H,1,8-11H2,2-6H3.
What are the key properties of 2-methylbut-3-en-2-yl (3-methyl-3-propan-2-ylcyclohexyl) carbonate?
2-methylbut-3-en-2-yl (3-methyl-3-propan-2-ylcyclohexyl) carbonate has a molecular weight of 268.40 g/mol, XLogP of 4.71, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbut-3-en-2-yl (3-methyl-3-propan-2-ylcyclohexyl) carbonate is sourced from PubChem (CID 21484555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).