About 2-cyclohexyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)acetamide
2-cyclohexyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)acetamide (PubChem CID 2148467) has the molecular formula C14H21N3O3
and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-cyclohexyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)acetamide.
Molecular Properties
| Compound Name | 2-cyclohexyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)acetamide |
| PubChem CID | 2148467 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2-cyclohexyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)acetamide |
| SMILES | Cn1c(NC(=O)CC2CCCCC2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C14H21N3O3/c1-16-11(9-13(19)17(2)14(16)20)15-12(18)8-10-6-4-3-5-7-10/h9-10H,3-8H2,1-2H3,(H,15,18) |
| InChIKey | GESGFEUFFPHPMT-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyclohexyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)acetamide?
The IUPAC name of 2-cyclohexyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)acetamide (CID 2148467) is 2-cyclohexyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)acetamide.
What is the SMILES notation for 2-cyclohexyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)acetamide?
The canonical SMILES for 2-cyclohexyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)acetamide is Cn1c(NC(=O)CC2CCCCC2)cc(=O)n(C)c1=O.
What is the InChIKey of 2-cyclohexyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)acetamide?
The InChIKey is GESGFEUFFPHPMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O3/c1-16-11(9-13(19)17(2)14(16)20)15-12(18)8-10-6-4-3-5-7-10/h9-10H,3-8H2,1-2H3,(H,15,18).
What are the key properties of 2-cyclohexyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)acetamide?
2-cyclohexyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)acetamide has a molecular weight of 279.34 g/mol, XLogP of 0.99, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)acetamide is sourced from PubChem (CID 2148467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).