About 4-chloro-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)benzamide
4-chloro-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)benzamide (PubChem CID 2148478) has the molecular formula C13H12ClN3O3
and a molecular weight of 293.71 g/mol. Its IUPAC name is 4-chloro-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)benzamide.
Molecular Properties
| Compound Name | 4-chloro-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)benzamide |
| PubChem CID | 2148478 |
| Molecular Formula | C13H12ClN3O3 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 4-chloro-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)benzamide |
| SMILES | Cn1c(NC(=O)c2ccc(Cl)cc2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C13H12ClN3O3/c1-16-10(7-11(18)17(2)13(16)20)15-12(19)8-3-5-9(14)6-4-8/h3-7H,1-2H3,(H,15,19) |
| InChIKey | VGXBJKIGFZWIME-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)benzamide?
The IUPAC name of 4-chloro-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)benzamide (CID 2148478) is 4-chloro-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)benzamide.
What is the SMILES notation for 4-chloro-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)benzamide?
The canonical SMILES for 4-chloro-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)benzamide is Cn1c(NC(=O)c2ccc(Cl)cc2)cc(=O)n(C)c1=O.
What is the InChIKey of 4-chloro-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)benzamide?
The InChIKey is VGXBJKIGFZWIME-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClN3O3/c1-16-10(7-11(18)17(2)13(16)20)15-12(19)8-3-5-9(14)6-4-8/h3-7H,1-2H3,(H,15,19).
What are the key properties of 4-chloro-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)benzamide?
4-chloro-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)benzamide has a molecular weight of 293.71 g/mol, XLogP of 0.99, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)benzamide is sourced from PubChem (CID 2148478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).