About 1-(2-benzyl-1,3-oxazolidin-3-yl)-3-chloropropan-2-ol
1-(2-benzyl-1,3-oxazolidin-3-yl)-3-chloropropan-2-ol (PubChem CID 21484973) has the molecular formula C13H18ClNO2
and a molecular weight of 255.75 g/mol. Its IUPAC name is 1-(2-benzyl-1,3-oxazolidin-3-yl)-3-chloropropan-2-ol.
Molecular Properties
| Compound Name | 1-(2-benzyl-1,3-oxazolidin-3-yl)-3-chloropropan-2-ol |
| PubChem CID | 21484973 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 1-(2-benzyl-1,3-oxazolidin-3-yl)-3-chloropropan-2-ol |
| SMILES | OC(CCl)CN1CCOC1Cc1ccccc1 |
| InChI | InChI=1S/C13H18ClNO2/c14-9-12(16)10-15-6-7-17-13(15)8-11-4-2-1-3-5-11/h1-5,12-13,16H,6-10H2 |
| InChIKey | HOJCHULMHILPFI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-benzyl-1,3-oxazolidin-3-yl)-3-chloropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-benzyl-1,3-oxazolidin-3-yl)-3-chloropropan-2-ol?
The IUPAC name of 1-(2-benzyl-1,3-oxazolidin-3-yl)-3-chloropropan-2-ol (CID 21484973) is 1-(2-benzyl-1,3-oxazolidin-3-yl)-3-chloropropan-2-ol.
What is the SMILES notation for 1-(2-benzyl-1,3-oxazolidin-3-yl)-3-chloropropan-2-ol?
The canonical SMILES for 1-(2-benzyl-1,3-oxazolidin-3-yl)-3-chloropropan-2-ol is OC(CCl)CN1CCOC1Cc1ccccc1.
What is the InChIKey of 1-(2-benzyl-1,3-oxazolidin-3-yl)-3-chloropropan-2-ol?
The InChIKey is HOJCHULMHILPFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18ClNO2/c14-9-12(16)10-15-6-7-17-13(15)8-11-4-2-1-3-5-11/h1-5,12-13,16H,6-10H2.
What are the key properties of 1-(2-benzyl-1,3-oxazolidin-3-yl)-3-chloropropan-2-ol?
1-(2-benzyl-1,3-oxazolidin-3-yl)-3-chloropropan-2-ol has a molecular weight of 255.75 g/mol, XLogP of 1.49, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-benzyl-1,3-oxazolidin-3-yl)-3-chloropropan-2-ol is sourced from PubChem (CID 21484973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).