About 2-(4-chlorophenoxy)-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-methylpropanamide
2-(4-chlorophenoxy)-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-methylpropanamide (PubChem CID 2148508) has the molecular formula C16H18ClN3O4
and a molecular weight of 351.79 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-methylpropanamide.
Molecular Properties
| Compound Name | 2-(4-chlorophenoxy)-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-methylpropanamide |
| PubChem CID | 2148508 |
| Molecular Formula | C16H18ClN3O4 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-methylpropanamide |
| SMILES | Cn1c(NC(=O)C(C)(C)Oc2ccc(Cl)cc2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C16H18ClN3O4/c1-16(2,24-11-7-5-10(17)6-8-11)14(22)18-12-9-13(21)20(4)15(23)19(12)3/h5-9H,1-4H3,(H,18,22) |
| InChIKey | PUMCQAZVHYAMNZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-chlorophenoxy)-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenoxy)-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-methylpropanamide?
The IUPAC name of 2-(4-chlorophenoxy)-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-methylpropanamide (CID 2148508) is 2-(4-chlorophenoxy)-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-methylpropanamide.
What is the SMILES notation for 2-(4-chlorophenoxy)-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-methylpropanamide?
The canonical SMILES for 2-(4-chlorophenoxy)-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-methylpropanamide is Cn1c(NC(=O)C(C)(C)Oc2ccc(Cl)cc2)cc(=O)n(C)c1=O.
What is the InChIKey of 2-(4-chlorophenoxy)-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-methylpropanamide?
The InChIKey is PUMCQAZVHYAMNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18ClN3O4/c1-16(2,24-11-7-5-10(17)6-8-11)14(22)18-12-9-13(21)20(4)15(23)19(12)3/h5-9H,1-4H3,(H,18,22).
What are the key properties of 2-(4-chlorophenoxy)-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-methylpropanamide?
2-(4-chlorophenoxy)-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-methylpropanamide has a molecular weight of 351.79 g/mol, XLogP of 1.53, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenoxy)-N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-methylpropanamide is sourced from PubChem (CID 2148508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).