C16H19N3O3 — CID 2148511
N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-4-phenylbutanamide (PubChem CID 2148511) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-4-phenylbutanamide.
| Compound Name | N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-4-phenylbutanamide |
|---|---|
| PubChem CID | 2148511 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-4-phenylbutanamide |
| SMILES | Cn1c(NC(=O)CCCc2ccccc2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C16H19N3O3/c1-18-13(11-15(21)19(2)16(18)22)17-14(20)10-6-9-12-7-4-3-5-8-12/h3-5,7-8,11H,6,9-10H2,1-2H3,(H,17,20) |
| InChIKey | DOYFSHZIAIDCKN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |