C13H11F2N3O3 — CID 2148513
N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-3,4-difluorobenzamide (PubChem CID 2148513) has the molecular formula C13H11F2N3O3 and a molecular weight of 295.25 g/mol. Its IUPAC name is N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-3,4-difluorobenzamide.
| Compound Name | N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 2148513 |
| Molecular Formula | C13H11F2N3O3 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | N-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-3,4-difluorobenzamide |
| SMILES | Cn1c(NC(=O)c2ccc(F)c(F)c2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C13H11F2N3O3/c1-17-10(6-11(19)18(2)13(17)21)16-12(20)7-3-4-8(14)9(15)5-7/h3-6H,1-2H3,(H,16,20) |
| InChIKey | NKHSXHGDVZYUMV-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |